Heme B

From Infogalactic: the planetary knowledge core
(Redirected from Heme b)
Jump to: navigation, search
Heme B
Skeletal formula of heme B
Space-filling model of the heme B complex
Names
Other names
Iron protoporphyrin IX,
protoheme IX
Identifiers
14875-96-8 YesY
ChemSpider 16739950 YesY
Jmol 3D model Interactive image
MeSH Heme+b
PubChem 444098
  • InChI=1S/C34H34N4O4.Fe/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,13-16H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+2/p-2/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-; YesY
    Key: KABFMIBPWCXCRK-RGGAHWMASA-L YesY
  • InChI=1/C34H34N4O4.Fe/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,13-16H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+2/p-2/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-;/rC34H32FeN4O4/c1-7-21-17(3)25-13-29-20(6)24(10-12-34(42)43)32-16-28-23(9-11-33(40)41)18(4)26(37-28)14-31-22(8-2)19(5)30(15-27(21)36-25)38(31)35-39(29)32/h7-8,13-16H,1-2,9-12H2,3-6H3,(H,40,41)(H,42,43)/b25-13-,26-14-,27-15-,28-16-,29-13-,30-15-,31-14-,32-16-
    Key: KABFMIBPWCXCRK-SMDPYJEOBB
  • OC(=O)CC/C6=C(\C)/C=3/N=C6/C=C2/C(/CCC(O)=O)=C(/C)\C1=C\C5=N\C(=C/c4n([Fe]N12)c(C=3)c(C=C)c4C)C(\C=C)=C5\C
Properties
C34H32O4N4Fe
Molar mass 616.487
Vapor pressure {{{value}}}
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
YesY verify (what is YesYN ?)
Infobox references

Heme B or haem B (also known as protoheme IX) is the most abundant heme. Hemoglobin and myoglobin are examples of oxygen transport proteins that contain heme B. The peroxidase family of enzymes also contain heme B. The COX-1 and COX-2 enzymes (cyclooxygenase) of recent fame, also contain heme B at one of two active sites.

Generally, heme B is attached to the surrounding protein matrix (known as the apoprotein) through a single coordination bond between the heme iron and an amino-acid side-chain.

Both hemoglobin and myoglobin have a coordination bond to an evolutionarily-conserved histidine, while nitric oxide synthase and cytochrome P450 have a coordination bond to an evolutionarily-conserved cysteine bound to the iron center of heme B.

Since the iron in heme B containing proteins is bound to the four nitrogens of the porphyrin (forming a plane) and a single electron donating atom of the protein, the iron is often in a pentacoordinate state. When oxygen or the toxic carbon monoxide is bound the iron becomes hexacoordinated.